C19H30O9 — CID 91294861
[2,3-diacetyloxy-3-(4-acetyloxy-3,6,6-trimethyloxan-2-yl)propyl] acetate (PubChem CID 91294861) has the molecular formula C19H30O9 and a molecular weight of 402.44 g/mol. Its IUPAC name is [2,3-diacetyloxy-3-(4-acetyloxy-3,6,6-trimethyloxan-2-yl)propyl] acetate.
| Compound Name | [2,3-diacetyloxy-3-(4-acetyloxy-3,6,6-trimethyloxan-2-yl)propyl] acetate |
|---|---|
| PubChem CID | 91294861 |
| Molecular Formula | C19H30O9 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | [2,3-diacetyloxy-3-(4-acetyloxy-3,6,6-trimethyloxan-2-yl)propyl] acetate |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C1OC(C)(C)CC(OC(C)=O)C1C |
| InChI | InChI=1S/C19H30O9/c1-10-15(25-12(3)21)8-19(6,7)28-17(10)18(27-14(5)23)16(26-13(4)22)9-24-11(2)20/h10,15-18H,8-9H2,1-7H3 |
| InChIKey | GWASLVLMWQFKEQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|