C21H37BrO4 — CID 135068806
[(1S,4R,7R)-10-bromo-1,4,9,9-tetramethyl-3-pentyl-2,8-dioxabicyclo[5.5.0]dodecan-4-yl] acetate (PubChem CID 135068806) has the molecular formula C21H37BrO4 and a molecular weight of 433.43 g/mol. Its IUPAC name is [(1S,4R,7R)-10-bromo-1,4,9,9-tetramethyl-3-pentyl-2,8-dioxabicyclo[5.5.0]dodecan-4-yl] acetate.
| Compound Name | [(1S,4R,7R)-10-bromo-1,4,9,9-tetramethyl-3-pentyl-2,8-dioxabicyclo[5.5.0]dodecan-4-yl] acetate |
|---|---|
| PubChem CID | 135068806 |
| Molecular Formula | C21H37BrO4 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | [(1S,4R,7R)-10-bromo-1,4,9,9-tetramethyl-3-pentyl-2,8-dioxabicyclo[5.5.0]dodecan-4-yl] acetate |
| SMILES | CCCCCC1O[C@@]2(C)CCC(Br)C(C)(C)O[C@@H]2CC[C@@]1(C)OC(C)=O |
| InChI | InChI=1S/C21H37BrO4/c1-7-8-9-10-17-20(5,24-15(2)23)14-12-18-21(6,26-17)13-11-16(22)19(3,4)25-18/h16-18H,7-14H2,1-6H3/t16?,17?,18-,20-,21+/m1/s1 |
| InChIKey | OYELLBADJNUKKH-PBJIVGMFSA-N |
| XLogP | 5.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|