C16H25BrO5 — CID 135069930
(1S,3S,8R,11R)-14-bromo-1,8,13,13-tetramethyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-6-one (PubChem CID 135069930) has the molecular formula C16H25BrO5 and a molecular weight of 377.28 g/mol. Its IUPAC name is (1S,3S,8R,11R)-14-bromo-1,8,13,13-tetramethyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-6-one.
| Compound Name | (1S,3S,8R,11R)-14-bromo-1,8,13,13-tetramethyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-6-one |
|---|---|
| PubChem CID | 135069930 |
| Molecular Formula | C16H25BrO5 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | (1S,3S,8R,11R)-14-bromo-1,8,13,13-tetramethyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-6-one |
| SMILES | CC1(C)O[C@@H]2CC[C@@]3(C)OC(=O)OC[C@@H]3O[C@@]2(C)CCC1Br |
| InChI | InChI=1S/C16H25BrO5/c1-14(2)10(17)5-7-15(3)11(20-14)6-8-16(4)12(21-15)9-19-13(18)22-16/h10-12H,5-9H2,1-4H3/t10?,11-,12+,15+,16-/m1/s1 |
| InChIKey | VBADHDRXOHOKPN-UMMBHIFBSA-N |
| XLogP | 3.57 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|