C15H24O6 — CID 135069536
(1S,3S,8R,11R)-13-methoxy-1,8-dimethyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-6-one (PubChem CID 135069536) has the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. Its IUPAC name is (1S,3S,8R,11R)-13-methoxy-1,8-dimethyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-6-one.
| Compound Name | (1S,3S,8R,11R)-13-methoxy-1,8-dimethyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-6-one |
|---|---|
| PubChem CID | 135069536 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (1S,3S,8R,11R)-13-methoxy-1,8-dimethyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-6-one |
| SMILES | COC1CCC[C@]2(C)O[C@H]3COC(=O)O[C@]3(C)CC[C@H]2O1 |
| InChI | InChI=1S/C15H24O6/c1-14-7-4-5-12(17-3)19-10(14)6-8-15(2)11(20-14)9-18-13(16)21-15/h10-12H,4-9H2,1-3H3/t10-,11+,12?,14+,15-/m1/s1 |
| InChIKey | NZHBEGVVUUZGRK-QTJLYVRGSA-N |
| XLogP | 2.39 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |