C16H26O6 — CID 134865654
(1S,3R,8S,11R,14R)-14-hydroxy-1,8,13,13-tetramethyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-6-one (PubChem CID 134865654) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is (1S,3R,8S,11R,14R)-14-hydroxy-1,8,13,13-tetramethyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-6-one.
| Compound Name | (1S,3R,8S,11R,14R)-14-hydroxy-1,8,13,13-tetramethyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-6-one |
|---|---|
| PubChem CID | 134865654 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (1S,3R,8S,11R,14R)-14-hydroxy-1,8,13,13-tetramethyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-6-one |
| SMILES | CC1(C)O[C@@H]2CC[C@]3(C)OC(=O)OC[C@H]3O[C@@]2(C)CC[C@H]1O |
| InChI | InChI=1S/C16H26O6/c1-14(2)10(17)5-7-15(3)11(20-14)6-8-16(4)12(21-15)9-19-13(18)22-16/h10-12,17H,5-9H2,1-4H3/t10-,11-,12-,15+,16+/m1/s1 |
| InChIKey | XBWHKAWXRYTWDK-ZQGUGBBBSA-N |
| XLogP | 2.17 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |