C14H22O6 — CID 134931514
tert-butyl [(1R,3R,4S,6S,8R,9R)-9-hydroxy-6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-4-yl] carbonate (PubChem CID 134931514) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is tert-butyl [(1R,3R,4S,6S,8R,9R)-9-hydroxy-6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-4-yl] carbonate.
| Compound Name | tert-butyl [(1R,3R,4S,6S,8R,9R)-9-hydroxy-6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-4-yl] carbonate |
|---|---|
| PubChem CID | 134931514 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | tert-butyl [(1R,3R,4S,6S,8R,9R)-9-hydroxy-6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-4-yl] carbonate |
| SMILES | CC(C)(C)OC(=O)O[C@H]1C[C@]2(C)O[C@@]3(C)[C@@H]1O[C@@H]3[C@H]2O |
| InChI | InChI=1S/C14H22O6/c1-12(2,3)19-11(16)17-7-6-13(4)8(15)10-14(5,20-13)9(7)18-10/h7-10,15H,6H2,1-5H3/t7-,8+,9+,10+,13-,14-/m0/s1 |
| InChIKey | LTXLXJNSSPBESB-FZXFYOPVSA-N |
| XLogP | 1.39 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |