C21H34O7 — CID 11058419
(1R,3S,6R,9R,12S,14R,19S)-6-hydroxy-3,7,7,12,19-pentamethyl-2,8,13,16,18-pentaoxatetracyclo[10.9.0.03,9.014,19]henicosan-17-one (PubChem CID 11058419) has the molecular formula C21H34O7 and a molecular weight of 398.50 g/mol. Its IUPAC name is (1R,3S,6R,9R,12S,14R,19S)-6-hydroxy-3,7,7,12,19-pentamethyl-2,8,13,16,18-pentaoxatetracyclo[10.9.0.03,9.014,19]henicosan-17-one.
| Compound Name | (1R,3S,6R,9R,12S,14R,19S)-6-hydroxy-3,7,7,12,19-pentamethyl-2,8,13,16,18-pentaoxatetracyclo[10.9.0.03,9.014,19]henicosan-17-one |
|---|---|
| PubChem CID | 11058419 |
| Molecular Formula | C21H34O7 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | (1R,3S,6R,9R,12S,14R,19S)-6-hydroxy-3,7,7,12,19-pentamethyl-2,8,13,16,18-pentaoxatetracyclo[10.9.0.03,9.014,19]henicosan-17-one |
| SMILES | CC1(C)O[C@@H]2CC[C@]3(C)O[C@@H]4COC(=O)O[C@@]4(C)CC[C@H]3O[C@@]2(C)CC[C@H]1O |
| InChI | InChI=1S/C21H34O7/c1-18(2)13(22)6-9-19(3)14(25-18)7-10-20(4)15(26-19)8-11-21(5)16(27-20)12-24-17(23)28-21/h13-16,22H,6-12H2,1-5H3/t13-,14-,15-,16-,19+,20+,21+/m1/s1 |
| InChIKey | ABZSZQTVKRGVCI-JKMCDVCNSA-N |
| XLogP | 3.11 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |