C19H30O7 — CID 135010548
(1R,3S,6R,9R,12S,14R,19S)-6-hydroxy-7,7,19-trimethyl-2,8,13,16,18-pentaoxatetracyclo[10.9.0.03,9.014,19]henicosan-17-one (PubChem CID 135010548) has the molecular formula C19H30O7 and a molecular weight of 370.44 g/mol. Its IUPAC name is (1R,3S,6R,9R,12S,14R,19S)-6-hydroxy-7,7,19-trimethyl-2,8,13,16,18-pentaoxatetracyclo[10.9.0.03,9.014,19]henicosan-17-one.
| Compound Name | (1R,3S,6R,9R,12S,14R,19S)-6-hydroxy-7,7,19-trimethyl-2,8,13,16,18-pentaoxatetracyclo[10.9.0.03,9.014,19]henicosan-17-one |
|---|---|
| PubChem CID | 135010548 |
| Molecular Formula | C19H30O7 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | (1R,3S,6R,9R,12S,14R,19S)-6-hydroxy-7,7,19-trimethyl-2,8,13,16,18-pentaoxatetracyclo[10.9.0.03,9.014,19]henicosan-17-one |
| SMILES | CC1(C)O[C@@H]2CC[C@@H]3O[C@@H]4COC(=O)O[C@@]4(C)CC[C@H]3O[C@H]2CC[C@H]1O |
| InChI | InChI=1S/C19H30O7/c1-18(2)15(20)7-6-12-14(25-18)5-4-11-13(23-12)8-9-19(3)16(24-11)10-22-17(21)26-19/h11-16,20H,4-10H2,1-3H3/t11-,12-,13+,14+,15+,16+,19-/m0/s1 |
| InChIKey | ZPAYWALUDSFGHC-QJRSUXNHSA-N |
| XLogP | 2.33 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |