C14H22O6 — CID 135067886
(1S,3R,8S,11R)-13-methoxy-8-methyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-6-one (PubChem CID 135067886) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is (1S,3R,8S,11R)-13-methoxy-8-methyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-6-one.
| Compound Name | (1S,3R,8S,11R)-13-methoxy-8-methyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-6-one |
|---|---|
| PubChem CID | 135067886 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (1S,3R,8S,11R)-13-methoxy-8-methyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-6-one |
| SMILES | COC1CCC[C@@H]2O[C@@H]3COC(=O)O[C@@]3(C)CC[C@H]2O1 |
| InChI | InChI=1S/C14H22O6/c1-14-7-6-10-9(4-3-5-12(16-2)19-10)18-11(14)8-17-13(15)20-14/h9-12H,3-8H2,1-2H3/t9-,10+,11+,12?,14-/m0/s1 |
| InChIKey | HEYTVHUZRXEXNO-PNSFIKPISA-N |
| XLogP | 2.00 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |