C21H39BrO3 — CID 135069288
(1S,4R,7R)-10-bromo-4-ethoxy-1,4,9,9-tetramethyl-3-pentyl-2,8-dioxabicyclo[5.5.0]dodecane (PubChem CID 135069288) has the molecular formula C21H39BrO3 and a molecular weight of 419.44 g/mol. Its IUPAC name is (1S,4R,7R)-10-bromo-4-ethoxy-1,4,9,9-tetramethyl-3-pentyl-2,8-dioxabicyclo[5.5.0]dodecane.
| Compound Name | (1S,4R,7R)-10-bromo-4-ethoxy-1,4,9,9-tetramethyl-3-pentyl-2,8-dioxabicyclo[5.5.0]dodecane |
|---|---|
| PubChem CID | 135069288 |
| Molecular Formula | C21H39BrO3 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | (1S,4R,7R)-10-bromo-4-ethoxy-1,4,9,9-tetramethyl-3-pentyl-2,8-dioxabicyclo[5.5.0]dodecane |
| SMILES | CCCCCC1O[C@@]2(C)CCC(Br)C(C)(C)O[C@@H]2CC[C@@]1(C)OCC |
| InChI | InChI=1S/C21H39BrO3/c1-7-9-10-11-17-20(5,23-8-2)15-13-18-21(6,25-17)14-12-16(22)19(3,4)24-18/h16-18H,7-15H2,1-6H3/t16?,17?,18-,20-,21+/m1/s1 |
| InChIKey | AOSAGMBIAJMHDA-PBJIVGMFSA-N |
| XLogP | 6.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|