About [2,2-dimethyl-6-(2-oxo-1,3-dioxolan-4-yl)oxan-3-yl] acetate
[2,2-dimethyl-6-(2-oxo-1,3-dioxolan-4-yl)oxan-3-yl] acetate (PubChem CID 135037768) has the molecular formula C12H18O6
and a molecular weight of 258.27 g/mol. Its IUPAC name is [2,2-dimethyl-6-(2-oxo-1,3-dioxolan-4-yl)oxan-3-yl] acetate.
Analyze [2,2-dimethyl-6-(2-oxo-1,3-dioxolan-4-yl)oxan-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-dimethyl-6-(2-oxo-1,3-dioxolan-4-yl)oxan-3-yl] acetate?
The IUPAC name of [2,2-dimethyl-6-(2-oxo-1,3-dioxolan-4-yl)oxan-3-yl] acetate (CID 135037768) is [2,2-dimethyl-6-(2-oxo-1,3-dioxolan-4-yl)oxan-3-yl] acetate.
What is the SMILES notation for [2,2-dimethyl-6-(2-oxo-1,3-dioxolan-4-yl)oxan-3-yl] acetate?
The canonical SMILES for [2,2-dimethyl-6-(2-oxo-1,3-dioxolan-4-yl)oxan-3-yl] acetate is CC(=O)OC1CCC(C2COC(=O)O2)OC1(C)C.
What is the InChIKey of [2,2-dimethyl-6-(2-oxo-1,3-dioxolan-4-yl)oxan-3-yl] acetate?
The InChIKey is JAENJMZPRTWSHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O6/c1-7(13)16-10-5-4-8(18-12(10,2)3)9-6-15-11(14)17-9/h8-10H,4-6H2,1-3H3.
What are the key properties of [2,2-dimethyl-6-(2-oxo-1,3-dioxolan-4-yl)oxan-3-yl] acetate?
[2,2-dimethyl-6-(2-oxo-1,3-dioxolan-4-yl)oxan-3-yl] acetate has a molecular weight of 258.27 g/mol, XLogP of 1.41, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-dimethyl-6-(2-oxo-1,3-dioxolan-4-yl)oxan-3-yl] acetate is sourced from PubChem (CID 135037768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).