C13H24O5 — CID 134967116
[(4S,6R)-2,2-dimethoxy-6-(2-methylpropyl)oxan-4-yl] acetate (PubChem CID 134967116) has the molecular formula C13H24O5 and a molecular weight of 260.33 g/mol. Its IUPAC name is [(4S,6R)-2,2-dimethoxy-6-(2-methylpropyl)oxan-4-yl] acetate.
| Compound Name | [(4S,6R)-2,2-dimethoxy-6-(2-methylpropyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 134967116 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | [(4S,6R)-2,2-dimethoxy-6-(2-methylpropyl)oxan-4-yl] acetate |
| SMILES | COC1(OC)C[C@@H](OC(C)=O)C[C@@H](CC(C)C)O1 |
| InChI | InChI=1S/C13H24O5/c1-9(2)6-11-7-12(17-10(3)14)8-13(15-4,16-5)18-11/h9,11-12H,6-8H2,1-5H3/t11-,12+/m1/s1 |
| InChIKey | AXNWAPKMOUNJPB-NEPJUHHUSA-N |
| XLogP | 2.09 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|