ethyl 2-(2-methoxy-6-propan-2-yloxan-2-yl)acetate

C13H24O4 — CID 134998976

IUPACethyl 2-(2-methoxy-6-propan-2-yloxan-2-yl)acetate
SMILESCCOC(=O)CC1(OC)CCCC(C(C)C)O1
InChIInChI=1S/C13H24O4/c1-5-16-12(14)9-13(15-4)8-6-7-11(17-13)10(2)3/h10-11H,5-9H2,1-4H3
InChIKeyXJSBNDJFYNNVMM-UHFFFAOYSA-N
MW244.33 g/mol
LogP2.51
Rot. Bonds5

About ethyl 2-(2-methoxy-6-propan-2-yloxan-2-yl)acetate

ethyl 2-(2-methoxy-6-propan-2-yloxan-2-yl)acetate (PubChem CID 134998976) has the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. Its IUPAC name is ethyl 2-(2-methoxy-6-propan-2-yloxan-2-yl)acetate.

Molecular Properties

Compound Nameethyl 2-(2-methoxy-6-propan-2-yloxan-2-yl)acetate
PubChem CID134998976
Molecular FormulaC13H24O4
Molecular Weight244.33 g/mol
Exact Mass244.17
IUPAC Nameethyl 2-(2-methoxy-6-propan-2-yloxan-2-yl)acetate
SMILESCCOC(=O)CC1(OC)CCCC(C(C)C)O1
InChIInChI=1S/C13H24O4/c1-5-16-12(14)9-13(15-4)8-6-7-11(17-13)10(2)3/h10-11H,5-9H2,1-4H3
InChIKeyXJSBNDJFYNNVMM-UHFFFAOYSA-N
XLogP2.51
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.33
LogP ≤ 52.51
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl 2-(2-methoxy-6-propan-2-yloxan-2-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-(2-methoxy-6-propan-2-yloxan-2-yl)acetate?
The IUPAC name of ethyl 2-(2-methoxy-6-propan-2-yloxan-2-yl)acetate (CID 134998976) is ethyl 2-(2-methoxy-6-propan-2-yloxan-2-yl)acetate.
What is the SMILES notation for ethyl 2-(2-methoxy-6-propan-2-yloxan-2-yl)acetate?
The canonical SMILES for ethyl 2-(2-methoxy-6-propan-2-yloxan-2-yl)acetate is CCOC(=O)CC1(OC)CCCC(C(C)C)O1.
What is the InChIKey of ethyl 2-(2-methoxy-6-propan-2-yloxan-2-yl)acetate?
The InChIKey is XJSBNDJFYNNVMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O4/c1-5-16-12(14)9-13(15-4)8-6-7-11(17-13)10(2)3/h10-11H,5-9H2,1-4H3.
What are the key properties of ethyl 2-(2-methoxy-6-propan-2-yloxan-2-yl)acetate?
ethyl 2-(2-methoxy-6-propan-2-yloxan-2-yl)acetate has a molecular weight of 244.33 g/mol, XLogP of 2.51, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2-methoxy-6-propan-2-yloxan-2-yl)acetate is sourced from PubChem (CID 134998976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).