C19H40O6Si — CID 90759063
ethane;[(2S,4S,5R)-6-(methoxymethyl)-2,4-dimethyl-5-(2-trimethylsilylethoxymethoxy)oxan-3-yl] acetate (PubChem CID 90759063) has the molecular formula C19H40O6Si and a molecular weight of 392.61 g/mol. Its IUPAC name is ethane;[(2S,4S,5R)-6-(methoxymethyl)-2,4-dimethyl-5-(2-trimethylsilylethoxymethoxy)oxan-3-yl] acetate.
| Compound Name | ethane;[(2S,4S,5R)-6-(methoxymethyl)-2,4-dimethyl-5-(2-trimethylsilylethoxymethoxy)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 90759063 |
| Molecular Formula | C19H40O6Si |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | ethane;[(2S,4S,5R)-6-(methoxymethyl)-2,4-dimethyl-5-(2-trimethylsilylethoxymethoxy)oxan-3-yl] acetate |
| SMILES | CC.COCC1O[C@@H](C)C(OC(C)=O)[C@@H](C)[C@H]1OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C17H34O6Si.C2H6/c1-12-16(23-14(3)18)13(2)22-15(10-19-4)17(12)21-11-20-8-9-24(5,6)7;1-2/h12-13,15-17H,8-11H2,1-7H3;1-2H3/t12-,13+,15?,16?,17-;/m1./s1 |
| InChIKey | QMIOSMKYVMHWJR-BFZDFXQESA-N |
| XLogP | 3.71 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|