C21H40O5Si — CID 11618260
[(2S,4R,5S,6R,8S,10R,11R)-4-[tert-butyl(dimethyl)silyl]oxy-2,5,8,11-tetramethyl-1,7-dioxaspiro[5.5]undecan-10-yl] acetate (PubChem CID 11618260) has the molecular formula C21H40O5Si and a molecular weight of 400.63 g/mol. Its IUPAC name is [(2S,4R,5S,6R,8S,10R,11R)-4-[tert-butyl(dimethyl)silyl]oxy-2,5,8,11-tetramethyl-1,7-dioxaspiro[5.5]undecan-10-yl] acetate.
| Compound Name | [(2S,4R,5S,6R,8S,10R,11R)-4-[tert-butyl(dimethyl)silyl]oxy-2,5,8,11-tetramethyl-1,7-dioxaspiro[5.5]undecan-10-yl] acetate |
|---|---|
| PubChem CID | 11618260 |
| Molecular Formula | C21H40O5Si |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | [(2S,4R,5S,6R,8S,10R,11R)-4-[tert-butyl(dimethyl)silyl]oxy-2,5,8,11-tetramethyl-1,7-dioxaspiro[5.5]undecan-10-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H](C)O[C@@]2(O[C@@H](C)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2C)[C@@H]1C |
| InChI | InChI=1S/C21H40O5Si/c1-13-11-18(23-17(5)22)15(3)21(24-13)16(4)19(12-14(2)25-21)26-27(9,10)20(6,7)8/h13-16,18-19H,11-12H2,1-10H3/t13-,14-,15+,16-,18+,19+,21+/m0/s1 |
| InChIKey | PIJGUBFCIKCOMQ-YCZRDLQQSA-N |
| XLogP | 4.89 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|