C29H60O4Si2 — CID 135054611
tert-butyl-[[(2R,3S,6R,8R,9S)-3,9-dimethyl-8-[2-tri(propan-2-yl)silyloxyethyl]-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy]-dimethylsilane (PubChem CID 135054611) has the molecular formula C29H60O4Si2 and a molecular weight of 528.97 g/mol. Its IUPAC name is tert-butyl-[[(2R,3S,6R,8R,9S)-3,9-dimethyl-8-[2-tri(propan-2-yl)silyloxyethyl]-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2R,3S,6R,8R,9S)-3,9-dimethyl-8-[2-tri(propan-2-yl)silyloxyethyl]-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 135054611 |
| Molecular Formula | C29H60O4Si2 |
| Molecular Weight | 528.97 g/mol |
| Exact Mass | 528.40 |
| IUPAC Name | tert-butyl-[[(2R,3S,6R,8R,9S)-3,9-dimethyl-8-[2-tri(propan-2-yl)silyloxyethyl]-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy]-dimethylsilane |
| SMILES | CC(C)[Si](OCC[C@H]1O[C@]2(CC[C@H](C)[C@H](CO[Si](C)(C)C(C)(C)C)O2)CC[C@@H]1C)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H60O4Si2/c1-21(2)35(22(3)4,23(5)6)30-19-16-26-24(7)14-17-29(32-26)18-15-25(8)27(33-29)20-31-34(12,13)28(9,10)11/h21-27H,14-20H2,1-13H3/t24-,25-,26+,27-,29+/m0/s1 |
| InChIKey | DITKAGPTQAGJLY-DYXRGMLLSA-N |
| XLogP | 8.92 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.97 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|