C25H48O7 — CID 134878393
(4S,5R,6R)-4-[(2S)-3-methoxy-4-(2-methoxypropan-2-yloxy)butan-2-yl]-2,2,5-trimethyl-6-[(1R)-1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]ethyl]-1,3-dioxane (PubChem CID 134878393) has the molecular formula C25H48O7 and a molecular weight of 460.65 g/mol. Its IUPAC name is (4S,5R,6R)-4-[(2S)-3-methoxy-4-(2-methoxypropan-2-yloxy)butan-2-yl]-2,2,5-trimethyl-6-[(1R)-1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]ethyl]-1,3-dioxane.
| Compound Name | (4S,5R,6R)-4-[(2S)-3-methoxy-4-(2-methoxypropan-2-yloxy)butan-2-yl]-2,2,5-trimethyl-6-[(1R)-1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 134878393 |
| Molecular Formula | C25H48O7 |
| Molecular Weight | 460.65 g/mol |
| Exact Mass | 460.34 |
| IUPAC Name | (4S,5R,6R)-4-[(2S)-3-methoxy-4-(2-methoxypropan-2-yloxy)butan-2-yl]-2,2,5-trimethyl-6-[(1R)-1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]ethyl]-1,3-dioxane |
| SMILES | COC(COC(C)(C)OC)[C@@H](C)[C@H]1OC(C)(C)O[C@H]([C@H](C)[C@H]2OC(C)(C)OC[C@@H]2C)[C@H]1C |
| InChI | InChI=1S/C25H48O7/c1-15-13-28-24(7,8)30-20(15)17(3)22-18(4)21(31-25(9,10)32-22)16(2)19(26-11)14-29-23(5,6)27-12/h15-22H,13-14H2,1-12H3/t15-,16+,17+,18-,19?,20-,21+,22+/m0/s1 |
| InChIKey | AFXQBUYENXVASJ-NYTQSOJMSA-N |
| XLogP | 4.62 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.65 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|