C17H28O5 — CID 10870683
(2S,4aS,6R,8aR)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,6-dimethyl-6-[(2S)-oxiran-2-yl]-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran (PubChem CID 10870683) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is (2S,4aS,6R,8aR)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,6-dimethyl-6-[(2S)-oxiran-2-yl]-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran.
| Compound Name | (2S,4aS,6R,8aR)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,6-dimethyl-6-[(2S)-oxiran-2-yl]-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran |
|---|---|
| PubChem CID | 10870683 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | (2S,4aS,6R,8aR)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,6-dimethyl-6-[(2S)-oxiran-2-yl]-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran |
| SMILES | CC1(C)OC[C@H]([C@]2(C)CC[C@@H]3O[C@@](C)([C@@H]4CO4)CC[C@H]3O2)O1 |
| InChI | InChI=1S/C17H28O5/c1-15(2)19-10-14(22-15)17(4)8-6-11-12(21-17)5-7-16(3,20-11)13-9-18-13/h11-14H,5-10H2,1-4H3/t11-,12+,13-,14+,16+,17-/m0/s1 |
| InChIKey | SGMSTPGLGNXZTO-MZCHXOHHSA-N |
| XLogP | 2.41 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|