C16H28O5 — CID 134878770
(3R,4S,5S,6R)-3-[(2S,4R,5R)-5-ethyl-2,4-dimethyl-1,3-dioxolan-4-yl]-1,4,6-trimethyl-2,8,9-trioxabicyclo[3.3.1]nonane (PubChem CID 134878770) has the molecular formula C16H28O5 and a molecular weight of 300.40 g/mol. Its IUPAC name is (3R,4S,5S,6R)-3-[(2S,4R,5R)-5-ethyl-2,4-dimethyl-1,3-dioxolan-4-yl]-1,4,6-trimethyl-2,8,9-trioxabicyclo[3.3.1]nonane.
| Compound Name | (3R,4S,5S,6R)-3-[(2S,4R,5R)-5-ethyl-2,4-dimethyl-1,3-dioxolan-4-yl]-1,4,6-trimethyl-2,8,9-trioxabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 134878770 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | (3R,4S,5S,6R)-3-[(2S,4R,5R)-5-ethyl-2,4-dimethyl-1,3-dioxolan-4-yl]-1,4,6-trimethyl-2,8,9-trioxabicyclo[3.3.1]nonane |
| SMILES | CC[C@H]1O[C@H](C)O[C@@]1(C)[C@@H]1OC2(C)OC[C@@H](C)[C@H](O2)[C@@H]1C |
| InChI | InChI=1S/C16H28O5/c1-7-12-15(5,19-11(4)18-12)14-10(3)13-9(2)8-17-16(6,20-13)21-14/h9-14H,7-8H2,1-6H3/t9-,10+,11+,12-,13+,14-,15-,16?/m1/s1 |
| InChIKey | SZCKNYLTGOMXIY-RZJQYLBESA-N |
| XLogP | 2.68 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |