C17H32O6 — CID 10903707
(4aR,6R,8S,8aR)-6-[(2S)-2,3-dimethoxypropyl]-8-methoxy-2,2,7,7-tetramethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine (PubChem CID 10903707) has the molecular formula C17H32O6 and a molecular weight of 332.44 g/mol. Its IUPAC name is (4aR,6R,8S,8aR)-6-[(2S)-2,3-dimethoxypropyl]-8-methoxy-2,2,7,7-tetramethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine.
| Compound Name | (4aR,6R,8S,8aR)-6-[(2S)-2,3-dimethoxypropyl]-8-methoxy-2,2,7,7-tetramethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 10903707 |
| Molecular Formula | C17H32O6 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | (4aR,6R,8S,8aR)-6-[(2S)-2,3-dimethoxypropyl]-8-methoxy-2,2,7,7-tetramethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine |
| SMILES | COC[C@H](C[C@H]1O[C@@H]2COC(C)(C)O[C@@H]2[C@@H](OC)C1(C)C)OC |
| InChI | InChI=1S/C17H32O6/c1-16(2)13(8-11(19-6)9-18-5)22-12-10-21-17(3,4)23-14(12)15(16)20-7/h11-15H,8-10H2,1-7H3/t11-,12+,13+,14-,15+/m0/s1 |
| InChIKey | BWROHIPNEWQGIX-VYDRJRHOSA-N |
| XLogP | 2.00 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |