About 2-[(2R,3R)-5,5-dimethyl-2-(oxan-2-yloxy)octan-3-yl]oxyoxane
2-[(2R,3R)-5,5-dimethyl-2-(oxan-2-yloxy)octan-3-yl]oxyoxane (PubChem CID 57290216) has the molecular formula C20H38O4
and a molecular weight of 342.52 g/mol. Its IUPAC name is 2-[(2R,3R)-5,5-dimethyl-2-(oxan-2-yloxy)octan-3-yl]oxyoxane.
Molecular Properties
| Compound Name | 2-[(2R,3R)-5,5-dimethyl-2-(oxan-2-yloxy)octan-3-yl]oxyoxane |
| PubChem CID | 57290216 |
| Molecular Formula | C20H38O4 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.28 |
| IUPAC Name | 2-[(2R,3R)-5,5-dimethyl-2-(oxan-2-yloxy)octan-3-yl]oxyoxane |
| SMILES | CCCC(C)(C)C[C@@H](OC1CCCCO1)[C@@H](C)OC1CCCCO1 |
| InChI | InChI=1S/C20H38O4/c1-5-12-20(3,4)15-17(24-19-11-7-9-14-22-19)16(2)23-18-10-6-8-13-21-18/h16-19H,5-15H2,1-4H3/t16-,17-,18?,19?/m1/s1 |
| InChIKey | WTRCAXXEFJMCPC-YYZRRKBYSA-N |
| XLogP | 5.05 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2R,3R)-5,5-dimethyl-2-(oxan-2-yloxy)octan-3-yl]oxyoxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R,3R)-5,5-dimethyl-2-(oxan-2-yloxy)octan-3-yl]oxyoxane?
The IUPAC name of 2-[(2R,3R)-5,5-dimethyl-2-(oxan-2-yloxy)octan-3-yl]oxyoxane (CID 57290216) is 2-[(2R,3R)-5,5-dimethyl-2-(oxan-2-yloxy)octan-3-yl]oxyoxane.
What is the SMILES notation for 2-[(2R,3R)-5,5-dimethyl-2-(oxan-2-yloxy)octan-3-yl]oxyoxane?
The canonical SMILES for 2-[(2R,3R)-5,5-dimethyl-2-(oxan-2-yloxy)octan-3-yl]oxyoxane is CCCC(C)(C)C[C@@H](OC1CCCCO1)[C@@H](C)OC1CCCCO1.
What is the InChIKey of 2-[(2R,3R)-5,5-dimethyl-2-(oxan-2-yloxy)octan-3-yl]oxyoxane?
The InChIKey is WTRCAXXEFJMCPC-YYZRRKBYSA-N. The full InChI is InChI=1S/C20H38O4/c1-5-12-20(3,4)15-17(24-19-11-7-9-14-22-19)16(2)23-18-10-6-8-13-21-18/h16-19H,5-15H2,1-4H3/t16-,17-,18?,19?/m1/s1.
What are the key properties of 2-[(2R,3R)-5,5-dimethyl-2-(oxan-2-yloxy)octan-3-yl]oxyoxane?
2-[(2R,3R)-5,5-dimethyl-2-(oxan-2-yloxy)octan-3-yl]oxyoxane has a molecular weight of 342.52 g/mol, XLogP of 5.05, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R,3R)-5,5-dimethyl-2-(oxan-2-yloxy)octan-3-yl]oxyoxane is sourced from PubChem (CID 57290216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).