C20H38O4 — CID 57290216
2-[(2R,3R)-5,5-dimethyl-2-(oxan-2-yloxy)octan-3-yl]oxyoxane (PubChem CID 57290216) has the molecular formula C20H38O4 and a molecular weight of 342.52 g/mol. Its IUPAC name is 2-[(2R,3R)-5,5-dimethyl-2-(oxan-2-yloxy)octan-3-yl]oxyoxane.
| Compound Name | 2-[(2R,3R)-5,5-dimethyl-2-(oxan-2-yloxy)octan-3-yl]oxyoxane |
|---|---|
| PubChem CID | 57290216 |
| Molecular Formula | C20H38O4 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.28 |
| IUPAC Name | 2-[(2R,3R)-5,5-dimethyl-2-(oxan-2-yloxy)octan-3-yl]oxyoxane |
| SMILES | CCCC(C)(C)C[C@@H](OC1CCCCO1)[C@@H](C)OC1CCCCO1 |
| InChI | InChI=1S/C20H38O4/c1-5-12-20(3,4)15-17(24-19-11-7-9-14-22-19)16(2)23-18-10-6-8-13-21-18/h16-19H,5-15H2,1-4H3/t16-,17-,18?,19?/m1/s1 |
| InChIKey | WTRCAXXEFJMCPC-YYZRRKBYSA-N |
| XLogP | 5.05 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |