C14H22O4 — CID 11219010
(2S,4aS,6R,8aR)-2,6-dimethyl-6-[(2S)-oxiran-2-yl]-2-[(2R)-oxiran-2-yl]-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran (PubChem CID 11219010) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is (2S,4aS,6R,8aR)-2,6-dimethyl-6-[(2S)-oxiran-2-yl]-2-[(2R)-oxiran-2-yl]-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran.
| Compound Name | (2S,4aS,6R,8aR)-2,6-dimethyl-6-[(2S)-oxiran-2-yl]-2-[(2R)-oxiran-2-yl]-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran |
|---|---|
| PubChem CID | 11219010 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (2S,4aS,6R,8aR)-2,6-dimethyl-6-[(2S)-oxiran-2-yl]-2-[(2R)-oxiran-2-yl]-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran |
| SMILES | C[C@]1([C@@H]2CO2)CC[C@H]2O[C@](C)([C@H]3CO3)CC[C@@H]2O1 |
| InChI | InChI=1S/C14H22O4/c1-13(11-7-15-11)5-3-10-9(17-13)4-6-14(2,18-10)12-8-16-12/h9-12H,3-8H2,1-2H3/t9-,10+,11-,12+,13+,14- |
| InChIKey | GFTMSFBDOQYAQJ-QSWPVVRKSA-N |
| XLogP | 1.66 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|