C17H30O6 — CID 134972722
(2R,3S,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[2-[(2S,3S)-3-(hydroxymethyl)-2-methyloxiran-2-yl]ethyl]-6-methyloxan-3-ol (PubChem CID 134972722) has the molecular formula C17H30O6 and a molecular weight of 330.42 g/mol. Its IUPAC name is (2R,3S,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[2-[(2S,3S)-3-(hydroxymethyl)-2-methyloxiran-2-yl]ethyl]-6-methyloxan-3-ol.
| Compound Name | (2R,3S,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[2-[(2S,3S)-3-(hydroxymethyl)-2-methyloxiran-2-yl]ethyl]-6-methyloxan-3-ol |
|---|---|
| PubChem CID | 134972722 |
| Molecular Formula | C17H30O6 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | (2R,3S,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[2-[(2S,3S)-3-(hydroxymethyl)-2-methyloxiran-2-yl]ethyl]-6-methyloxan-3-ol |
| SMILES | CC1(C)OC[C@H]([C@]2(C)CC[C@H](O)[C@@H](CC[C@]3(C)O[C@H]3CO)O2)O1 |
| InChI | InChI=1S/C17H30O6/c1-15(2)20-10-14(22-15)17(4)7-5-11(19)12(21-17)6-8-16(3)13(9-18)23-16/h11-14,18-19H,5-10H2,1-4H3/t11-,12+,13-,14+,16-,17-/m0/s1 |
| InChIKey | QNICWVRDAIKPLY-UIWYYIFQSA-N |
| XLogP | 1.37 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|