C9H16O6 — CID 54113684
(3R,4S,5R)-3-[(1R)-1,2-dihydroxyethyl]-6,6-dimethyl-2-oxabicyclo[3.1.0]hexane-1,4,5-triol (PubChem CID 54113684) has the molecular formula C9H16O6 and a molecular weight of 220.22 g/mol. Its IUPAC name is (3R,4S,5R)-3-[(1R)-1,2-dihydroxyethyl]-6,6-dimethyl-2-oxabicyclo[3.1.0]hexane-1,4,5-triol.
| Compound Name | (3R,4S,5R)-3-[(1R)-1,2-dihydroxyethyl]-6,6-dimethyl-2-oxabicyclo[3.1.0]hexane-1,4,5-triol |
|---|---|
| PubChem CID | 54113684 |
| Molecular Formula | C9H16O6 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | (3R,4S,5R)-3-[(1R)-1,2-dihydroxyethyl]-6,6-dimethyl-2-oxabicyclo[3.1.0]hexane-1,4,5-triol |
| SMILES | CC1(C)C2(O)O[C@H]([C@H](O)CO)[C@H](O)[C@]12O |
| InChI | InChI=1S/C9H16O6/c1-7(2)8(13)6(12)5(4(11)3-10)15-9(7,8)14/h4-6,10-14H,3H2,1-2H3/t4-,5-,6+,8+,9?/m1/s1 |
| InChIKey | NIVSSMREMGWQRX-MYJJLRATSA-N |
| XLogP | -2.44 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |