C8H14O5 — CID 54086435
(1S,3R,4S,5R)-3-(hydroxymethyl)-6,6-dimethyl-2-oxabicyclo[3.1.0]hexane-1,4,5-triol (PubChem CID 54086435) has the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. Its IUPAC name is (1S,3R,4S,5R)-3-(hydroxymethyl)-6,6-dimethyl-2-oxabicyclo[3.1.0]hexane-1,4,5-triol.
| Compound Name | (1S,3R,4S,5R)-3-(hydroxymethyl)-6,6-dimethyl-2-oxabicyclo[3.1.0]hexane-1,4,5-triol |
|---|---|
| PubChem CID | 54086435 |
| Molecular Formula | C8H14O5 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | (1S,3R,4S,5R)-3-(hydroxymethyl)-6,6-dimethyl-2-oxabicyclo[3.1.0]hexane-1,4,5-triol |
| SMILES | CC1(C)[C@]2(O)O[C@H](CO)[C@H](O)[C@]12O |
| InChI | InChI=1S/C8H14O5/c1-6(2)7(11)5(10)4(3-9)13-8(6,7)12/h4-5,9-12H,3H2,1-2H3/t4-,5+,7+,8+/m1/s1 |
| InChIKey | MQVANIQGFOQNKU-ZILMGAKASA-N |
| XLogP | -1.80 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |