C10H16O3 — CID 10986963
(1S,2S,4'S,5S)-1,4'-dimethylspiro[3,6-dioxabicyclo[3.1.0]hexane-2,2'-oxane] (PubChem CID 10986963) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is (1S,2S,4'S,5S)-1,4'-dimethylspiro[3,6-dioxabicyclo[3.1.0]hexane-2,2'-oxane].
| Compound Name | (1S,2S,4'S,5S)-1,4'-dimethylspiro[3,6-dioxabicyclo[3.1.0]hexane-2,2'-oxane] |
|---|---|
| PubChem CID | 10986963 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (1S,2S,4'S,5S)-1,4'-dimethylspiro[3,6-dioxabicyclo[3.1.0]hexane-2,2'-oxane] |
| SMILES | C[C@H]1CCO[C@@]2(C1)OC[C@@H]1O[C@@]12C |
| InChI | InChI=1S/C10H16O3/c1-7-3-4-11-10(5-7)9(2)8(13-9)6-12-10/h7-8H,3-6H2,1-2H3/t7-,8-,9-,10-/m0/s1 |
| InChIKey | WTPHGMQUJMVALL-XKNYDFJKSA-N |
| XLogP | 1.32 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|