C15H28O2 — CID 10999136
(2S,3R,6S)-3-methyl-2-pentan-3-yl-1,7-dioxaspiro[5.5]undecane (PubChem CID 10999136) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is (2S,3R,6S)-3-methyl-2-pentan-3-yl-1,7-dioxaspiro[5.5]undecane.
| Compound Name | (2S,3R,6S)-3-methyl-2-pentan-3-yl-1,7-dioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 10999136 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (2S,3R,6S)-3-methyl-2-pentan-3-yl-1,7-dioxaspiro[5.5]undecane |
| SMILES | CCC(CC)[C@H]1O[C@@]2(CCCCO2)CC[C@H]1C |
| InChI | InChI=1S/C15H28O2/c1-4-13(5-2)14-12(3)8-10-15(17-14)9-6-7-11-16-15/h12-14H,4-11H2,1-3H3/t12-,14+,15+/m1/s1 |
| InChIKey | DTLNKMXHMWZILG-SNPRPXQTSA-N |
| XLogP | 4.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |