C19H38O7Si — CID 46894693
[(5R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-(2-methoxyethoxymethoxy)oxan-2-yl] acetate (PubChem CID 46894693) has the molecular formula C19H38O7Si and a molecular weight of 406.59 g/mol. Its IUPAC name is [(5R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-(2-methoxyethoxymethoxy)oxan-2-yl] acetate.
| Compound Name | [(5R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-(2-methoxyethoxymethoxy)oxan-2-yl] acetate |
|---|---|
| PubChem CID | 46894693 |
| Molecular Formula | C19H38O7Si |
| Molecular Weight | 406.59 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | [(5R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-(2-methoxyethoxymethoxy)oxan-2-yl] acetate |
| SMILES | COCCOCO[C@@H]1CCC(OC(C)=O)O[C@@H]1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H38O7Si/c1-15(20)25-18-9-8-16(23-14-22-13-12-21-5)17(26-18)10-11-24-27(6,7)19(2,3)4/h16-18H,8-14H2,1-7H3/t16-,17-,18?/m1/s1 |
| InChIKey | OKIXYKUJYIHEJD-OWZOALSMSA-N |
| XLogP | 3.47 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.59 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|