C29H52O10Si2 — CID 11262053
[(2R,3R,4S,5R,6R)-5-acetyloxy-6-[(3R)-3-acetyloxypent-4-ynoxy]-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-3-yl] acetate (PubChem CID 11262053) has the molecular formula C29H52O10Si2 and a molecular weight of 616.90 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-5-acetyloxy-6-[(3R)-3-acetyloxypent-4-ynoxy]-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-5-acetyloxy-6-[(3R)-3-acetyloxypent-4-ynoxy]-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 11262053 |
| Molecular Formula | C29H52O10Si2 |
| Molecular Weight | 616.90 g/mol |
| Exact Mass | 616.31 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-5-acetyloxy-6-[(3R)-3-acetyloxypent-4-ynoxy]-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-3-yl] acetate |
| SMILES | C#C[C@@H](CCO[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](OC(C)=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C29H52O10Si2/c1-15-22(35-19(2)30)16-17-33-27-26(37-21(4)32)25(39-41(13,14)29(8,9)10)24(36-20(3)31)23(38-27)18-34-40(11,12)28(5,6)7/h1,22-27H,16-18H2,2-14H3/t22-,23+,24+,25-,26+,27+/m0/s1 |
| InChIKey | RZFASLNPLSTNDM-KPBLZALBSA-N |
| XLogP | 4.96 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.90 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|