C16H36O4Si2 — CID 90908938
tert-butyl-[(2S,3S,4R,6S)-6-methoxy-2-methyl-4-trimethylsilyloxyoxan-3-yl]oxy-dimethylsilane (PubChem CID 90908938) has the molecular formula C16H36O4Si2 and a molecular weight of 348.63 g/mol. Its IUPAC name is tert-butyl-[(2S,3S,4R,6S)-6-methoxy-2-methyl-4-trimethylsilyloxyoxan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3S,4R,6S)-6-methoxy-2-methyl-4-trimethylsilyloxyoxan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 90908938 |
| Molecular Formula | C16H36O4Si2 |
| Molecular Weight | 348.63 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | tert-butyl-[(2S,3S,4R,6S)-6-methoxy-2-methyl-4-trimethylsilyloxyoxan-3-yl]oxy-dimethylsilane |
| SMILES | CO[C@@H]1C[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)O1 |
| InChI | InChI=1S/C16H36O4Si2/c1-12-15(20-22(9,10)16(2,3)4)13(19-21(6,7)8)11-14(17-5)18-12/h12-15H,11H2,1-10H3/t12-,13+,14-,15-/m0/s1 |
| InChIKey | FIOLZCFJBLGUEW-XGUBFFRZSA-N |
| XLogP | 4.38 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.63 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|