C15H27FO6Si — CID 18665150
[(2S,3R,4R,5S,6S)-4-acetyloxy-5-fluoro-2-methyl-6-(2-trimethylsilylethoxy)oxan-3-yl] acetate (PubChem CID 18665150) has the molecular formula C15H27FO6Si and a molecular weight of 350.46 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6S)-4-acetyloxy-5-fluoro-2-methyl-6-(2-trimethylsilylethoxy)oxan-3-yl] acetate.
| Compound Name | [(2S,3R,4R,5S,6S)-4-acetyloxy-5-fluoro-2-methyl-6-(2-trimethylsilylethoxy)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 18665150 |
| Molecular Formula | C15H27FO6Si |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | [(2S,3R,4R,5S,6S)-4-acetyloxy-5-fluoro-2-methyl-6-(2-trimethylsilylethoxy)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](F)[C@@H](OCC[Si](C)(C)C)O[C@@H](C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H27FO6Si/c1-9-13(21-10(2)17)14(22-11(3)18)12(16)15(20-9)19-7-8-23(4,5)6/h9,12-15H,7-8H2,1-6H3/t9-,12-,13+,14-,15-/m0/s1 |
| InChIKey | ATQIDLUUEXLCFI-WNBCSMFUSA-N |
| XLogP | 2.29 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|