C20H38O5Si — CID 101382083
[(3S,5R,6S,10R,11S)-10-[tert-butyl(dimethyl)silyl]oxy-3,5,11-trimethyl-1,7-dioxaspiro[5.5]undecan-3-yl] acetate (PubChem CID 101382083) has the molecular formula C20H38O5Si and a molecular weight of 386.61 g/mol. Its IUPAC name is [(3S,5R,6S,10R,11S)-10-[tert-butyl(dimethyl)silyl]oxy-3,5,11-trimethyl-1,7-dioxaspiro[5.5]undecan-3-yl] acetate.
| Compound Name | [(3S,5R,6S,10R,11S)-10-[tert-butyl(dimethyl)silyl]oxy-3,5,11-trimethyl-1,7-dioxaspiro[5.5]undecan-3-yl] acetate |
|---|---|
| PubChem CID | 101382083 |
| Molecular Formula | C20H38O5Si |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | [(3S,5R,6S,10R,11S)-10-[tert-butyl(dimethyl)silyl]oxy-3,5,11-trimethyl-1,7-dioxaspiro[5.5]undecan-3-yl] acetate |
| SMILES | CC(=O)O[C@]1(C)CO[C@@]2(OCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2C)[C@H](C)C1 |
| InChI | InChI=1S/C20H38O5Si/c1-14-12-19(7,24-16(3)21)13-23-20(14)15(2)17(10-11-22-20)25-26(8,9)18(4,5)6/h14-15,17H,10-13H2,1-9H3/t14-,15+,17-,19+,20+/m1/s1 |
| InChIKey | QXAFMRDQHPMHAA-UPSZCFJUSA-N |
| XLogP | 4.51 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|