C19H38O5Si — CID 72713817
[(4R,6S)-6-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2R)-oxiran-2-yl]ethyl]-2,2-diethyl-1,3-dioxan-4-yl]methanol (PubChem CID 72713817) has the molecular formula C19H38O5Si and a molecular weight of 374.59 g/mol. Its IUPAC name is [(4R,6S)-6-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2R)-oxiran-2-yl]ethyl]-2,2-diethyl-1,3-dioxan-4-yl]methanol.
| Compound Name | [(4R,6S)-6-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2R)-oxiran-2-yl]ethyl]-2,2-diethyl-1,3-dioxan-4-yl]methanol |
|---|---|
| PubChem CID | 72713817 |
| Molecular Formula | C19H38O5Si |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | [(4R,6S)-6-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2R)-oxiran-2-yl]ethyl]-2,2-diethyl-1,3-dioxan-4-yl]methanol |
| SMILES | CCC1(CC)O[C@@H](CO)C[C@@H]([C@H](CO[Si](C)(C)C(C)(C)C)[C@@H]2CO2)O1 |
| InChI | InChI=1S/C19H38O5Si/c1-8-19(9-2)23-14(11-20)10-16(24-19)15(17-13-21-17)12-22-25(6,7)18(3,4)5/h14-17,20H,8-13H2,1-7H3/t14-,15+,16+,17+/m1/s1 |
| InChIKey | IGSUKJJLWPUUEH-QZWWFDLISA-N |
| XLogP | 3.71 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|