C19H38O5Si — CID 71523827
[(2S,3S)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4S,6R)-2,2,6-trimethyl-1,3-dioxepan-4-yl]ethyl]oxiran-2-yl]methanol (PubChem CID 71523827) has the molecular formula C19H38O5Si and a molecular weight of 374.59 g/mol. Its IUPAC name is [(2S,3S)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4S,6R)-2,2,6-trimethyl-1,3-dioxepan-4-yl]ethyl]oxiran-2-yl]methanol.
| Compound Name | [(2S,3S)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4S,6R)-2,2,6-trimethyl-1,3-dioxepan-4-yl]ethyl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 71523827 |
| Molecular Formula | C19H38O5Si |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | [(2S,3S)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4S,6R)-2,2,6-trimethyl-1,3-dioxepan-4-yl]ethyl]oxiran-2-yl]methanol |
| SMILES | C[C@H]1COC(C)(C)O[C@H]([C@H](C[C@@H]2O[C@H]2CO)O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C19H38O5Si/c1-13-9-15(23-19(5,6)21-12-13)16(10-14-17(11-20)22-14)24-25(7,8)18(2,3)4/h13-17,20H,9-12H2,1-8H3/t13-,14+,15+,16+,17+/m1/s1 |
| InChIKey | AVNWQTHRLMKFSS-XAJHFOFHSA-N |
| XLogP | 3.70 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|