C17H36O4Si — CID 71523786
(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,6R)-2,2,6-trimethyl-1,3-dioxepan-4-yl]propan-1-ol (PubChem CID 71523786) has the molecular formula C17H36O4Si and a molecular weight of 332.56 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,6R)-2,2,6-trimethyl-1,3-dioxepan-4-yl]propan-1-ol.
| Compound Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,6R)-2,2,6-trimethyl-1,3-dioxepan-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 71523786 |
| Molecular Formula | C17H36O4Si |
| Molecular Weight | 332.56 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,6R)-2,2,6-trimethyl-1,3-dioxepan-4-yl]propan-1-ol |
| SMILES | C[C@H]1COC(C)(C)O[C@H]([C@H](CCO)O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C17H36O4Si/c1-13-11-15(20-17(5,6)19-12-13)14(9-10-18)21-22(7,8)16(2,3)4/h13-15,18H,9-12H2,1-8H3/t13-,14+,15+/m1/s1 |
| InChIKey | KCDUEBXQEZQKEM-ILXRZTDVSA-N |
| XLogP | 3.94 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|