C22H46O4Si — CID 134863685
(2R,3R,4R)-2-methyl-4-[(4S,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]-1-tri(propan-2-yl)silyloxypentan-3-ol (PubChem CID 134863685) has the molecular formula C22H46O4Si and a molecular weight of 402.69 g/mol. Its IUPAC name is (2R,3R,4R)-2-methyl-4-[(4S,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]-1-tri(propan-2-yl)silyloxypentan-3-ol.
| Compound Name | (2R,3R,4R)-2-methyl-4-[(4S,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]-1-tri(propan-2-yl)silyloxypentan-3-ol |
|---|---|
| PubChem CID | 134863685 |
| Molecular Formula | C22H46O4Si |
| Molecular Weight | 402.69 g/mol |
| Exact Mass | 402.32 |
| IUPAC Name | (2R,3R,4R)-2-methyl-4-[(4S,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]-1-tri(propan-2-yl)silyloxypentan-3-ol |
| SMILES | CC(C)[Si](OC[C@@H](C)[C@@H](O)[C@@H](C)[C@H]1OC(C)(C)OC[C@H]1C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H46O4Si/c1-14(2)27(15(3)4,16(5)6)25-13-17(7)20(23)19(9)21-18(8)12-24-22(10,11)26-21/h14-21,23H,12-13H2,1-11H3/t17-,18-,19-,20-,21+/m1/s1 |
| InChIKey | HXXKHKWTNVUMNW-ONUIULTDSA-N |
| XLogP | 5.60 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.69 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|