C23H41F3O5Si — CID 22889256
2-[5-[3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl]-4-methoxy-3-methylideneoxolan-2-yl]ethyl 2,2-dimethylpropanoate (PubChem CID 22889256) has the molecular formula C23H41F3O5Si and a molecular weight of 482.66 g/mol. Its IUPAC name is 2-[5-[3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl]-4-methoxy-3-methylideneoxolan-2-yl]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[5-[3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl]-4-methoxy-3-methylideneoxolan-2-yl]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 22889256 |
| Molecular Formula | C23H41F3O5Si |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | 2-[5-[3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl]-4-methoxy-3-methylideneoxolan-2-yl]ethyl 2,2-dimethylpropanoate |
| SMILES | C=C1C(CCOC(=O)C(C)(C)C)OC(CCC(O[Si](C)(C)C(C)(C)C)C(F)(F)F)C1OC |
| InChI | InChI=1S/C23H41F3O5Si/c1-15-16(13-14-29-20(27)21(2,3)4)30-17(19(15)28-8)11-12-18(23(24,25)26)31-32(9,10)22(5,6)7/h16-19H,1,11-14H2,2-10H3 |
| InChIKey | CLDSSUMJEUPRPH-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|