C27H54O6Si2 — CID 59916205
[(2R,4R,5R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-methoxy-3-methylideneoxolan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 59916205) has the molecular formula C27H54O6Si2 and a molecular weight of 530.90 g/mol. Its IUPAC name is [(2R,4R,5R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-methoxy-3-methylideneoxolan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,4R,5R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-methoxy-3-methylideneoxolan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 59916205 |
| Molecular Formula | C27H54O6Si2 |
| Molecular Weight | 530.90 g/mol |
| Exact Mass | 530.35 |
| IUPAC Name | [(2R,4R,5R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-methoxy-3-methylideneoxolan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | C=C1[C@H](COC(=O)C(C)(C)C)O[C@H](C[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H]1OC |
| InChI | InChI=1S/C27H54O6Si2/c1-19-22(18-30-24(28)25(2,3)4)32-21(23(19)29-11)16-20(33-35(14,15)27(8,9)10)17-31-34(12,13)26(5,6)7/h20-23H,1,16-18H2,2-15H3/t20-,21+,22-,23+/m0/s1 |
| InChIKey | MQEIBXNXVZDZEL-GSPCLOLRSA-N |
| XLogP | 6.72 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.90 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|