C28H48O5Si2 — CID 102325937
(1R,4S,13S,14S)-13-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,12-dimethylidene-5,15-dioxabicyclo[12.1.0]pentadec-9-yn-6-one (PubChem CID 102325937) has the molecular formula C28H48O5Si2 and a molecular weight of 520.86 g/mol. Its IUPAC name is (1R,4S,13S,14S)-13-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,12-dimethylidene-5,15-dioxabicyclo[12.1.0]pentadec-9-yn-6-one.
| Compound Name | (1R,4S,13S,14S)-13-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,12-dimethylidene-5,15-dioxabicyclo[12.1.0]pentadec-9-yn-6-one |
|---|---|
| PubChem CID | 102325937 |
| Molecular Formula | C28H48O5Si2 |
| Molecular Weight | 520.86 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | (1R,4S,13S,14S)-13-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,12-dimethylidene-5,15-dioxabicyclo[12.1.0]pentadec-9-yn-6-one |
| SMILES | C=C1C[C@@H](CO[Si](C)(C)C(C)(C)C)OC(=O)CCC#CCC(=C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[C@H]12 |
| InChI | InChI=1S/C28H48O5Si2/c1-20-16-14-13-15-17-23(29)31-22(19-30-34(9,10)27(3,4)5)18-21(2)24-26(32-24)25(20)33-35(11,12)28(6,7)8/h22,24-26H,1-2,15-19H2,3-12H3/t22-,24+,25-,26-/m0/s1 |
| InChIKey | NWMYBXBLQUBVEH-TWFMJERGSA-N |
| XLogP | 6.77 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.86 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|