C30H52O5Si2 — CID 134887328
(1R,4S,13S,14S)-13-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,9,10,12-tetramethylidene-5,15-dioxabicyclo[12.1.0]pentadecan-6-one (PubChem CID 134887328) has the molecular formula C30H52O5Si2 and a molecular weight of 548.91 g/mol. Its IUPAC name is (1R,4S,13S,14S)-13-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,9,10,12-tetramethylidene-5,15-dioxabicyclo[12.1.0]pentadecan-6-one.
| Compound Name | (1R,4S,13S,14S)-13-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,9,10,12-tetramethylidene-5,15-dioxabicyclo[12.1.0]pentadecan-6-one |
|---|---|
| PubChem CID | 134887328 |
| Molecular Formula | C30H52O5Si2 |
| Molecular Weight | 548.91 g/mol |
| Exact Mass | 548.34 |
| IUPAC Name | (1R,4S,13S,14S)-13-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,9,10,12-tetramethylidene-5,15-dioxabicyclo[12.1.0]pentadecan-6-one |
| SMILES | C=C1CCC(=O)O[C@H](CO[Si](C)(C)C(C)(C)C)CC(=C)[C@H]2O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)C(=C)CC1=C |
| InChI | InChI=1S/C30H52O5Si2/c1-20-15-16-25(31)33-24(19-32-36(11,12)29(5,6)7)18-23(4)26-28(34-26)27(22(3)17-21(20)2)35-37(13,14)30(8,9)10/h24,26-28H,1-4,15-19H2,5-14H3/t24-,26+,27-,28-/m0/s1 |
| InChIKey | PRJKWFBILJPLPT-WHENYANWSA-N |
| XLogP | 7.88 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.91 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|