C31H46O4Si — CID 134983385
(1R,4S,13S,14S)-13-[tert-butyl(dimethyl)silyl]oxy-4-[(1E,4E)-6-methylhepta-1,4,6-trienyl]-2,9,10,12-tetramethylidene-5,15-dioxabicyclo[12.1.0]pentadecan-6-one (PubChem CID 134983385) has the molecular formula C31H46O4Si and a molecular weight of 510.79 g/mol. Its IUPAC name is (1R,4S,13S,14S)-13-[tert-butyl(dimethyl)silyl]oxy-4-[(1E,4E)-6-methylhepta-1,4,6-trienyl]-2,9,10,12-tetramethylidene-5,15-dioxabicyclo[12.1.0]pentadecan-6-one.
| Compound Name | (1R,4S,13S,14S)-13-[tert-butyl(dimethyl)silyl]oxy-4-[(1E,4E)-6-methylhepta-1,4,6-trienyl]-2,9,10,12-tetramethylidene-5,15-dioxabicyclo[12.1.0]pentadecan-6-one |
|---|---|
| PubChem CID | 134983385 |
| Molecular Formula | C31H46O4Si |
| Molecular Weight | 510.79 g/mol |
| Exact Mass | 510.32 |
| IUPAC Name | (1R,4S,13S,14S)-13-[tert-butyl(dimethyl)silyl]oxy-4-[(1E,4E)-6-methylhepta-1,4,6-trienyl]-2,9,10,12-tetramethylidene-5,15-dioxabicyclo[12.1.0]pentadecan-6-one |
| SMILES | C=C(C)/C=C/C/C=C/[C@@H]1CC(=C)[C@H]2O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)C(=C)CC(=C)C(=C)CCC(=O)O1 |
| InChI | InChI=1S/C31H46O4Si/c1-21(2)15-13-12-14-16-26-20-25(6)28-30(34-28)29(35-36(10,11)31(7,8)9)24(5)19-23(4)22(3)17-18-27(32)33-26/h13-16,26,28-30H,1,3-6,12,17-20H2,2,7-11H3/b15-13+,16-14+/t26-,28-,29+,30+/m1/s1 |
| InChIKey | VPTVVKQYNUCEHY-XEVIQQNSSA-N |
| XLogP | 7.93 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.79 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|