C30H62O6Si3 — CID 5377100
methyl 8-trimethylsilyloxy-8-[4-trimethylsilyloxy-5-[(E)-3-trimethylsilyloxyoct-1-enyl]oxolan-2-yl]octanoate (PubChem CID 5377100) has the molecular formula C30H62O6Si3 and a molecular weight of 603.08 g/mol. Its IUPAC name is methyl 8-trimethylsilyloxy-8-[4-trimethylsilyloxy-5-[(E)-3-trimethylsilyloxyoct-1-enyl]oxolan-2-yl]octanoate.
| Compound Name | methyl 8-trimethylsilyloxy-8-[4-trimethylsilyloxy-5-[(E)-3-trimethylsilyloxyoct-1-enyl]oxolan-2-yl]octanoate |
|---|---|
| PubChem CID | 5377100 |
| Molecular Formula | C30H62O6Si3 |
| Molecular Weight | 603.08 g/mol |
| Exact Mass | 602.39 |
| IUPAC Name | methyl 8-trimethylsilyloxy-8-[4-trimethylsilyloxy-5-[(E)-3-trimethylsilyloxyoct-1-enyl]oxolan-2-yl]octanoate |
| SMILES | CCCCCC(/C=C/C1OC(C(CCCCCCC(=O)OC)O[Si](C)(C)C)CC1O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C30H62O6Si3/c1-12-13-16-19-25(34-37(3,4)5)22-23-26-29(36-39(9,10)11)24-28(33-26)27(35-38(6,7)8)20-17-14-15-18-21-30(31)32-2/h22-23,25-29H,12-21,24H2,1-11H3/b23-22+ |
| InChIKey | VIQZTZTYCLDMEX-GHVJWSGMSA-N |
| XLogP | 8.45 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.08 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|