C27H48O5Si2 — CID 134887427
(1R,4S,13R,14S)-13-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-12-methylidene-5,15-dioxabicyclo[12.1.0]pentadec-9-yn-6-one (PubChem CID 134887427) has the molecular formula C27H48O5Si2 and a molecular weight of 508.85 g/mol. Its IUPAC name is (1R,4S,13R,14S)-13-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-12-methylidene-5,15-dioxabicyclo[12.1.0]pentadec-9-yn-6-one.
| Compound Name | (1R,4S,13R,14S)-13-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-12-methylidene-5,15-dioxabicyclo[12.1.0]pentadec-9-yn-6-one |
|---|---|
| PubChem CID | 134887427 |
| Molecular Formula | C27H48O5Si2 |
| Molecular Weight | 508.85 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | (1R,4S,13R,14S)-13-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-12-methylidene-5,15-dioxabicyclo[12.1.0]pentadec-9-yn-6-one |
| SMILES | C=C1CC#CCCC(=O)O[C@H](CO[Si](C)(C)C(C)(C)C)CC[C@H]2O[C@@H]2[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H48O5Si2/c1-20-15-13-12-14-16-23(28)30-21(19-29-33(8,9)26(2,3)4)17-18-22-25(31-22)24(20)32-34(10,11)27(5,6)7/h21-22,24-25H,1,14-19H2,2-11H3/t21-,22+,24+,25-/m0/s1 |
| InChIKey | QTAVIOHGNIZGCT-AICRDVKUSA-N |
| XLogP | 6.60 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.85 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|