C24H44O4Si — CID 153438113
[(2R,5S)-4-methylidene-5-[(3S)-5-methyl-3-triethylsilyloxyhex-5-enyl]oxolan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 153438113) has the molecular formula C24H44O4Si and a molecular weight of 424.70 g/mol. Its IUPAC name is [(2R,5S)-4-methylidene-5-[(3S)-5-methyl-3-triethylsilyloxyhex-5-enyl]oxolan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,5S)-4-methylidene-5-[(3S)-5-methyl-3-triethylsilyloxyhex-5-enyl]oxolan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 153438113 |
| Molecular Formula | C24H44O4Si |
| Molecular Weight | 424.70 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | [(2R,5S)-4-methylidene-5-[(3S)-5-methyl-3-triethylsilyloxyhex-5-enyl]oxolan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | C=C(C)C[C@H](CC[C@@H]1O[C@@H](COC(=O)C(C)(C)C)CC1=C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C24H44O4Si/c1-10-29(11-2,12-3)28-20(15-18(4)5)13-14-22-19(6)16-21(27-22)17-26-23(25)24(7,8)9/h20-22H,4,6,10-17H2,1-3,5,7-9H3/t20-,21+,22-/m0/s1 |
| InChIKey | IELBMONDXWSSMT-BDTNDASRSA-N |
| XLogP | 6.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.70 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|