C32H66O6Si4 — CID 5371731
trimethylsilyl (E)-8-trimethylsilyloxy-8-[4-trimethylsilyloxy-5-[(E)-3-trimethylsilyloxyoct-1-enyl]oxolan-2-yl]oct-5-enoate (PubChem CID 5371731) has the molecular formula C32H66O6Si4 and a molecular weight of 659.22 g/mol. Its IUPAC name is trimethylsilyl (E)-8-trimethylsilyloxy-8-[4-trimethylsilyloxy-5-[(E)-3-trimethylsilyloxyoct-1-enyl]oxolan-2-yl]oct-5-enoate.
| Compound Name | trimethylsilyl (E)-8-trimethylsilyloxy-8-[4-trimethylsilyloxy-5-[(E)-3-trimethylsilyloxyoct-1-enyl]oxolan-2-yl]oct-5-enoate |
|---|---|
| PubChem CID | 5371731 |
| Molecular Formula | C32H66O6Si4 |
| Molecular Weight | 659.22 g/mol |
| Exact Mass | 658.39 |
| IUPAC Name | trimethylsilyl (E)-8-trimethylsilyloxy-8-[4-trimethylsilyloxy-5-[(E)-3-trimethylsilyloxyoct-1-enyl]oxolan-2-yl]oct-5-enoate |
| SMILES | CCCCCC(/C=C/C1OC(C(C/C=C/CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C)CC1O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C32H66O6Si4/c1-14-15-18-21-27(35-39(2,3)4)24-25-28-31(37-41(8,9)10)26-30(34-28)29(36-40(5,6)7)22-19-16-17-20-23-32(33)38-42(11,12)13/h16,19,24-25,27-31H,14-15,17-18,20-23,26H2,1-13H3/b19-16+,25-24+ |
| InChIKey | GHSCHPFIJMZDGG-UWVAOJKCSA-N |
| XLogP | 9.44 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.22 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|