C28H51NO4Si2 — CID 91752989
trimethylsilyl (Z)-7-[(1R,2E,5R)-2-ethoxyimino-5-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopent-3-en-1-yl]hept-5-enoate (PubChem CID 91752989) has the molecular formula C28H51NO4Si2 and a molecular weight of 521.89 g/mol. Its IUPAC name is trimethylsilyl (Z)-7-[(1R,2E,5R)-2-ethoxyimino-5-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopent-3-en-1-yl]hept-5-enoate.
| Compound Name | trimethylsilyl (Z)-7-[(1R,2E,5R)-2-ethoxyimino-5-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopent-3-en-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 91752989 |
| Molecular Formula | C28H51NO4Si2 |
| Molecular Weight | 521.89 g/mol |
| Exact Mass | 521.34 |
| IUPAC Name | trimethylsilyl (Z)-7-[(1R,2E,5R)-2-ethoxyimino-5-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopent-3-en-1-yl]hept-5-enoate |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1C=C/C(=N\OCC)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C28H51NO4Si2/c1-9-11-14-17-25(32-34(3,4)5)22-20-24-21-23-27(29-31-10-2)26(24)18-15-12-13-16-19-28(30)33-35(6,7)8/h12,15,20-26H,9-11,13-14,16-19H2,1-8H3/b15-12-,22-20+,29-27+/t24-,25-,26+/m0/s1 |
| InChIKey | FAIKGANMUMFBOQ-OITWTDQISA-N |
| XLogP | 8.03 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.89 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|