C31H57NO4Si2 — CID 91752970
trimethylsilyl (Z)-7-[(1R,5R)-2-butoxyimino-5-[(E,3S)-3-methyl-3-trimethylsilyloxyoct-1-enyl]cyclopent-3-en-1-yl]hept-5-enoate (PubChem CID 91752970) has the molecular formula C31H57NO4Si2 and a molecular weight of 563.97 g/mol. Its IUPAC name is trimethylsilyl (Z)-7-[(1R,5R)-2-butoxyimino-5-[(E,3S)-3-methyl-3-trimethylsilyloxyoct-1-enyl]cyclopent-3-en-1-yl]hept-5-enoate.
| Compound Name | trimethylsilyl (Z)-7-[(1R,5R)-2-butoxyimino-5-[(E,3S)-3-methyl-3-trimethylsilyloxyoct-1-enyl]cyclopent-3-en-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 91752970 |
| Molecular Formula | C31H57NO4Si2 |
| Molecular Weight | 563.97 g/mol |
| Exact Mass | 563.38 |
| IUPAC Name | trimethylsilyl (Z)-7-[(1R,5R)-2-butoxyimino-5-[(E,3S)-3-methyl-3-trimethylsilyloxyoct-1-enyl]cyclopent-3-en-1-yl]hept-5-enoate |
| SMILES | CCCCC[C@@](C)(/C=C/[C@H]1C=CC(=NOCCCC)[C@@H]1C/C=C\CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C31H57NO4Si2/c1-10-12-18-24-31(3,36-38(7,8)9)25-23-27-21-22-29(32-34-26-13-11-2)28(27)19-16-14-15-17-20-30(33)35-37(4,5)6/h14,16,21-23,25,27-28H,10-13,15,17-20,24,26H2,1-9H3/b16-14-,25-23+,32-29?/t27-,28-,31+/m1/s1 |
| InChIKey | PFHNSQOPBICNCF-LBHHZVPWSA-N |
| XLogP | 9.20 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.97 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|