C32H63NO5Si3 — CID 91749039
trimethylsilyl (E)-7-[(1R,2R,3R,5E)-5-ethoxyimino-2-[(E,3S)-3-methyl-3-trimethylsilyloxyoct-1-enyl]-3-trimethylsilyloxycyclopentyl]hept-5-enoate (PubChem CID 91749039) has the molecular formula C32H63NO5Si3 and a molecular weight of 626.12 g/mol. Its IUPAC name is trimethylsilyl (E)-7-[(1R,2R,3R,5E)-5-ethoxyimino-2-[(E,3S)-3-methyl-3-trimethylsilyloxyoct-1-enyl]-3-trimethylsilyloxycyclopentyl]hept-5-enoate.
| Compound Name | trimethylsilyl (E)-7-[(1R,2R,3R,5E)-5-ethoxyimino-2-[(E,3S)-3-methyl-3-trimethylsilyloxyoct-1-enyl]-3-trimethylsilyloxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 91749039 |
| Molecular Formula | C32H63NO5Si3 |
| Molecular Weight | 626.12 g/mol |
| Exact Mass | 625.40 |
| IUPAC Name | trimethylsilyl (E)-7-[(1R,2R,3R,5E)-5-ethoxyimino-2-[(E,3S)-3-methyl-3-trimethylsilyloxyoct-1-enyl]-3-trimethylsilyloxycyclopentyl]hept-5-enoate |
| SMILES | CCCCC[C@@](C)(/C=C/[C@H]1[C@H](O[Si](C)(C)C)C/C(=N\OCC)[C@@H]1C/C=C/CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C32H63NO5Si3/c1-13-15-20-24-32(3,38-41(10,11)12)25-23-28-27(21-18-16-17-19-22-31(34)37-40(7,8)9)29(33-35-14-2)26-30(28)36-39(4,5)6/h16,18,23,25,27-28,30H,13-15,17,19-22,24,26H2,1-12H3/b18-16+,25-23+,33-29+/t27-,28-,30-,32+/m1/s1 |
| InChIKey | SDYVEINWPQZDCG-HHRYZPMGSA-N |
| XLogP | 9.48 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.12 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|