C31H61NO5Si3 — CID 20845705
trimethylsilyl (Z)-7-[(1S,2R,3R,5E)-5-ethoxyimino-3-trimethylsilyloxy-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 20845705) has the molecular formula C31H61NO5Si3 and a molecular weight of 612.09 g/mol. Its IUPAC name is trimethylsilyl (Z)-7-[(1S,2R,3R,5E)-5-ethoxyimino-3-trimethylsilyloxy-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | trimethylsilyl (Z)-7-[(1S,2R,3R,5E)-5-ethoxyimino-3-trimethylsilyloxy-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 20845705 |
| Molecular Formula | C31H61NO5Si3 |
| Molecular Weight | 612.09 g/mol |
| Exact Mass | 611.39 |
| IUPAC Name | trimethylsilyl (Z)-7-[(1S,2R,3R,5E)-5-ethoxyimino-3-trimethylsilyloxy-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@H](C/C=C\CCCC(=O)O[Si](C)(C)C)/C(=N/OCC)C[C@H]1O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C31H61NO5Si3/c1-12-14-17-20-26(35-38(3,4)5)23-24-28-27(21-18-15-16-19-22-31(33)37-40(9,10)11)29(32-34-13-2)25-30(28)36-39(6,7)8/h15,18,23-24,26-28,30H,12-14,16-17,19-22,25H2,1-11H3/b18-15-,24-23+,32-29+/t26-,27-,28+,30+/m0/s1 |
| InChIKey | AJOVLGPPFOBIEN-UKWSXVQOSA-N |
| XLogP | 9.09 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.09 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|