C28H53NO4Si2 — CID 635451
trimethylsilyl 7-[5-ethoxyimino-2-(3-trimethylsilyloxyoct-1-enyl)cyclopenten-1-yl]heptanoate (PubChem CID 635451) has the molecular formula C28H53NO4Si2 and a molecular weight of 523.91 g/mol. Its IUPAC name is trimethylsilyl 7-[5-ethoxyimino-2-(3-trimethylsilyloxyoct-1-enyl)cyclopenten-1-yl]heptanoate.
| Compound Name | trimethylsilyl 7-[5-ethoxyimino-2-(3-trimethylsilyloxyoct-1-enyl)cyclopenten-1-yl]heptanoate |
|---|---|
| PubChem CID | 635451 |
| Molecular Formula | C28H53NO4Si2 |
| Molecular Weight | 523.91 g/mol |
| Exact Mass | 523.35 |
| IUPAC Name | trimethylsilyl 7-[5-ethoxyimino-2-(3-trimethylsilyloxyoct-1-enyl)cyclopenten-1-yl]heptanoate |
| SMILES | CCCCCC(C=CC1=C(CCCCCCC(=O)O[Si](C)(C)C)C(=NOCC)CC1)O[Si](C)(C)C |
| InChI | InChI=1S/C28H53NO4Si2/c1-9-11-14-17-25(32-34(3,4)5)22-20-24-21-23-27(29-31-10-2)26(24)18-15-12-13-16-19-28(30)33-35(6,7)8/h20,22,25H,9-19,21,23H2,1-8H3 |
| InChIKey | OHZXJEKTFQCOQY-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.91 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|